C20H17N5OS2 — CID 135581444
(Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbut-2-enenitrile (PubChem CID 135581444) has the molecular formula C20H17N5OS2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbut-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbut-2-enenitrile |
|---|---|
| PubChem CID | 135581444 |
| Molecular Formula | C20H17N5OS2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbut-2-enenitrile |
| SMILES | Cc1nc(SC/C(O)=C(\C#N)c2nc3ccccc3[nH]2)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C20H17N5OS2/c1-10-11(2)28-20-17(10)19(22-12(3)23-20)27-9-16(26)13(8-21)18-24-14-6-4-5-7-15(14)25-18/h4-7,26H,9H2,1-3H3,(H,24,25)/b16-13- |
| InChIKey | HUOWMBOEUYQLLD-SSZFMOIBSA-N |
| XLogP | 5.08 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|