C19H13N5OS — CID 5096884
2-(1H-benzimidazol-2-yl)-3-hydroxy-4-quinazolin-4-ylsulfanylbut-2-enenitrile (PubChem CID 5096884) has the molecular formula C19H13N5OS and a molecular weight of 359.41 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-quinazolin-4-ylsulfanylbut-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-quinazolin-4-ylsulfanylbut-2-enenitrile |
|---|---|
| PubChem CID | 5096884 |
| Molecular Formula | C19H13N5OS |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-quinazolin-4-ylsulfanylbut-2-enenitrile |
| SMILES | N#CC(=C(O)CSc1ncnc2ccccc12)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H13N5OS/c20-9-13(18-23-15-7-3-4-8-16(15)24-18)17(25)10-26-19-12-5-1-2-6-14(12)21-11-22-19/h1-8,11,25H,10H2,(H,23,24) |
| InChIKey | SLZIVDQMGIIOEV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|