C14H10N6O3S — CID 2376191
2-(1H-benzimidazol-2-yl)-4-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 2376191) has the molecular formula C14H10N6O3S and a molecular weight of 342.34 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-4-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-4-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 2376191 |
| Molecular Formula | C14H10N6O3S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-4-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | N#CC(=C(O)CSc1n[nH]c(=O)[nH]c1=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H10N6O3S/c15-5-7(11-16-8-3-1-2-4-9(8)17-11)10(21)6-24-13-12(22)18-14(23)20-19-13/h1-4,21H,6H2,(H,16,17)(H2,18,20,22,23) |
| InChIKey | XZUCKRGAEBJEDR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 151.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|