C18H11ClN4OS2 — CID 3248609
2-(1H-benzimidazol-2-yl)-4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 3248609) has the molecular formula C18H11ClN4OS2 and a molecular weight of 398.90 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 3248609 |
| Molecular Formula | C18H11ClN4OS2 |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | N#CC(=C(O)CSc1nc2cc(Cl)ccc2s1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H11ClN4OS2/c19-10-5-6-16-14(7-10)23-18(26-16)25-9-15(24)11(8-20)17-21-12-3-1-2-4-13(12)22-17/h1-7,24H,9H2,(H,21,22) |
| InChIKey | CRJGDRAKBCHLKA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|