C19H18ClN3S3 — CID 20685292
2-[5-(1H-benzimidazol-2-ylsulfanyl)pentylsulfanyl]-5-chloro-1,3-benzothiazole (PubChem CID 20685292) has the molecular formula C19H18ClN3S3 and a molecular weight of 420.03 g/mol. Its IUPAC name is 2-[5-(1H-benzimidazol-2-ylsulfanyl)pentylsulfanyl]-5-chloro-1,3-benzothiazole.
| Compound Name | 2-[5-(1H-benzimidazol-2-ylsulfanyl)pentylsulfanyl]-5-chloro-1,3-benzothiazole |
|---|---|
| PubChem CID | 20685292 |
| Molecular Formula | C19H18ClN3S3 |
| Molecular Weight | 420.03 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 2-[5-(1H-benzimidazol-2-ylsulfanyl)pentylsulfanyl]-5-chloro-1,3-benzothiazole |
| SMILES | Clc1ccc2sc(SCCCCCSc3nc4ccccc4[nH]3)nc2c1 |
| InChI | InChI=1S/C19H18ClN3S3/c20-13-8-9-17-16(12-13)23-19(26-17)25-11-5-1-4-10-24-18-21-14-6-2-3-7-15(14)22-18/h2-3,6-9,12H,1,4-5,10-11H2,(H,21,22) |
| InChIKey | GIMFULPJTSBBAU-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.03 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|