C19H11Cl2N5OS3 — CID 5125063
2-(1H-benzimidazol-2-yl)-4-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 5125063) has the molecular formula C19H11Cl2N5OS3 and a molecular weight of 492.44 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-4-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-4-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 5125063 |
| Molecular Formula | C19H11Cl2N5OS3 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 490.95 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-4-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | N#CC(=C(O)CSc1nn(-c2ccc(Cl)c(Cl)c2)c(=S)s1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H11Cl2N5OS3/c20-12-6-5-10(7-13(12)21)26-19(28)30-18(25-26)29-9-16(27)11(8-22)17-23-14-3-1-2-4-15(14)24-17/h1-7,27H,9H2,(H,23,24) |
| InChIKey | MCXSPKIFTOQEJW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|