C19H17Cl2N4O+ — CID 135761708
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-[(2,4-dichlorophenyl)methyl]-methylazanium (PubChem CID 135761708) has the molecular formula C19H17Cl2N4O+ and a molecular weight of 388.28 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-[(2,4-dichlorophenyl)methyl]-methylazanium.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-[(2,4-dichlorophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 135761708 |
| Molecular Formula | C19H17Cl2N4O+ |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-[(2,4-dichlorophenyl)methyl]-methylazanium |
| SMILES | C[NH+](C/C(O)=C(\C#N)c1nc2ccccc2[nH]1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N4O/c1-25(10-12-6-7-13(20)8-15(12)21)11-18(26)14(9-22)19-23-16-4-2-3-5-17(16)24-19/h2-8,26H,10-11H2,1H3,(H,23,24)/p+1/b18-14- |
| InChIKey | YAEZLGJCHCBSLS-JXAWBTAJSA-O |
| XLogP | 3.38 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|