C17H22N5O2+ — CID 135625720
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-methyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium (PubChem CID 135625720) has the molecular formula C17H22N5O2+ and a molecular weight of 328.40 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-methyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-methyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium |
|---|---|
| PubChem CID | 135625720 |
| Molecular Formula | C17H22N5O2+ |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-methyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium |
| SMILES | CC(C)NC(=O)C[NH+](C)C/C(O)=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H21N5O2/c1-11(2)19-16(24)10-22(3)9-15(23)12(8-18)17-20-13-6-4-5-7-14(13)21-17/h4-7,11,23H,9-10H2,1-3H3,(H,19,24)(H,20,21)/p+1/b15-12- |
| InChIKey | PBIGWUTYUCOADK-QINSGFPZSA-O |
| XLogP | 0.39 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|