C20H21N4O2+ — CID 135761663
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-[(3-methoxyphenyl)methyl]-methylazanium (PubChem CID 135761663) has the molecular formula C20H21N4O2+ and a molecular weight of 349.41 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-[(3-methoxyphenyl)methyl]-methylazanium.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-[(3-methoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 135761663 |
| Molecular Formula | C20H21N4O2+ |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-[(3-methoxyphenyl)methyl]-methylazanium |
| SMILES | COc1cccc(C[NH+](C)C/C(O)=C(\C#N)c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C20H20N4O2/c1-24(12-14-6-5-7-15(10-14)26-2)13-19(25)16(11-21)20-22-17-8-3-4-9-18(17)23-20/h3-10,25H,12-13H2,1-2H3,(H,22,23)/p+1/b19-16- |
| InChIKey | WQEKPMZVMJKZDT-MNDPQUGUSA-O |
| XLogP | 2.08 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|