C23H27N4O3+ — CID 135749515
[(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]-[2-(3,4-dimethoxyphenyl)ethyl]-methylazanium (PubChem CID 135749515) has the molecular formula C23H27N4O3+ and a molecular weight of 407.49 g/mol. Its IUPAC name is [(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]-[2-(3,4-dimethoxyphenyl)ethyl]-methylazanium.
| Compound Name | [(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]-[2-(3,4-dimethoxyphenyl)ethyl]-methylazanium |
|---|---|
| PubChem CID | 135749515 |
| Molecular Formula | C23H27N4O3+ |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | [(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]-[2-(3,4-dimethoxyphenyl)ethyl]-methylazanium |
| SMILES | COc1ccc(CC[NH+](C)[C@H](C)/C(O)=C(\C#N)c2nc3ccccc3[nH]2)cc1OC |
| InChI | InChI=1S/C23H26N4O3/c1-15(27(2)12-11-16-9-10-20(29-3)21(13-16)30-4)22(28)17(14-24)23-25-18-7-5-6-8-19(18)26-23/h5-10,13,15,28H,11-12H2,1-4H3,(H,25,26)/p+1/b22-17-/t15-/m1/s1 |
| InChIKey | ZTWKMXOLUAJFGY-XQEBGNCTSA-O |
| XLogP | 2.52 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|