C23H23N3O5 — CID 135845691
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-methoxy-4-(2-methylpropoxy)benzoate (PubChem CID 135845691) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-methoxy-4-(2-methylpropoxy)benzoate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-methoxy-4-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 135845691 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-methoxy-4-(2-methylpropoxy)benzoate |
| SMILES | COc1cc(C(=O)OC/C(O)=C(\C#N)c2nc3ccccc3[nH]2)ccc1OCC(C)C |
| InChI | InChI=1S/C23H23N3O5/c1-14(2)12-30-20-9-8-15(10-21(20)29-3)23(28)31-13-19(27)16(11-24)22-25-17-6-4-5-7-18(17)26-22/h4-10,14,27H,12-13H2,1-3H3,(H,25,26)/b19-16- |
| InChIKey | YXEGQOFLDDZHRV-MNDPQUGUSA-N |
| XLogP | 4.26 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|