C20H15F2N3O5 — CID 135788519
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-(difluoromethoxy)-3-methoxybenzoate (PubChem CID 135788519) has the molecular formula C20H15F2N3O5 and a molecular weight of 415.35 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-(difluoromethoxy)-3-methoxybenzoate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-(difluoromethoxy)-3-methoxybenzoate |
|---|---|
| PubChem CID | 135788519 |
| Molecular Formula | C20H15F2N3O5 |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-(difluoromethoxy)-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OC/C(O)=C(\C#N)c2nc3ccccc3[nH]2)ccc1OC(F)F |
| InChI | InChI=1S/C20H15F2N3O5/c1-28-17-8-11(6-7-16(17)30-20(21)22)19(27)29-10-15(26)12(9-23)18-24-13-4-2-3-5-14(13)25-18/h2-8,20,26H,10H2,1H3,(H,24,25)/b15-12- |
| InChIKey | HIKZCTZYXBMBHG-QINSGFPZSA-N |
| XLogP | 3.82 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|