C18H12BrN3O3 — CID 137265746
[(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-bromobenzoate (PubChem CID 137265746) has the molecular formula C18H12BrN3O3 and a molecular weight of 398.22 g/mol. Its IUPAC name is [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-bromobenzoate.
| Compound Name | [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 137265746 |
| Molecular Formula | C18H12BrN3O3 |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-bromobenzoate |
| SMILES | N#C/C(=C(\O)COC(=O)c1ccc(Br)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H12BrN3O3/c19-12-7-5-11(6-8-12)18(24)25-10-16(23)13(9-20)17-21-14-3-1-2-4-15(14)22-17/h1-8,23H,10H2,(H,21,22)/b16-13+ |
| InChIKey | IFZNRJUUZQPLIO-DTQAZKPQSA-N |
| XLogP | 3.98 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|