C17H12BrN3O — CID 135562919
(Z)-2-(1H-benzimidazol-2-yl)-4-(4-bromophenyl)-3-hydroxybut-2-enenitrile (PubChem CID 135562919) has the molecular formula C17H12BrN3O and a molecular weight of 354.21 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-4-(4-bromophenyl)-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-4-(4-bromophenyl)-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135562919 |
| Molecular Formula | C17H12BrN3O |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-4-(4-bromophenyl)-3-hydroxybut-2-enenitrile |
| SMILES | N#C/C(=C(/O)Cc1ccc(Br)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H12BrN3O/c18-12-7-5-11(6-8-12)9-16(22)13(10-19)17-20-14-3-1-2-4-15(14)21-17/h1-8,22H,9H2,(H,20,21)/b16-13- |
| InChIKey | MOKINCDGJPWLEU-SSZFMOIBSA-N |
| XLogP | 4.36 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|