C17H11BrN2OS — CID 4702605
2-(1,3-benzothiazol-2-yl)-4-(4-bromophenyl)-3-hydroxybut-2-enenitrile (PubChem CID 4702605) has the molecular formula C17H11BrN2OS and a molecular weight of 371.26 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-(4-bromophenyl)-3-hydroxybut-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-(4-bromophenyl)-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 4702605 |
| Molecular Formula | C17H11BrN2OS |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-(4-bromophenyl)-3-hydroxybut-2-enenitrile |
| SMILES | N#CC(=C(O)Cc1ccc(Br)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H11BrN2OS/c18-12-7-5-11(6-8-12)9-15(21)13(10-19)17-20-14-3-1-2-4-16(14)22-17/h1-8,21H,9H2 |
| InChIKey | IIVOMXQOKVRNIZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|