C16H15N3OS3 — CID 135671623
[(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] pyrrolidine-1-carbodithioate (PubChem CID 135671623) has the molecular formula C16H15N3OS3 and a molecular weight of 361.52 g/mol. Its IUPAC name is [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] pyrrolidine-1-carbodithioate.
| Compound Name | [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 135671623 |
| Molecular Formula | C16H15N3OS3 |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] pyrrolidine-1-carbodithioate |
| SMILES | N#C/C(=C(/O)CSC(=S)N1CCCC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H15N3OS3/c17-9-11(15-18-12-5-1-2-6-14(12)23-15)13(20)10-22-16(21)19-7-3-4-8-19/h1-2,5-6,20H,3-4,7-8,10H2/b13-11- |
| InChIKey | ZLQWEMMNNYWPCJ-QBFSEMIESA-N |
| XLogP | 4.20 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|