C15H11N5O2S2 — CID 135752053
(Z)-4-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-2-(1,3-benzothiazol-2-yl)-3-hydroxybut-2-enenitrile (PubChem CID 135752053) has the molecular formula C15H11N5O2S2 and a molecular weight of 357.42 g/mol. Its IUPAC name is (Z)-4-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-2-(1,3-benzothiazol-2-yl)-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-4-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-2-(1,3-benzothiazol-2-yl)-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135752053 |
| Molecular Formula | C15H11N5O2S2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (Z)-4-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-2-(1,3-benzothiazol-2-yl)-3-hydroxybut-2-enenitrile |
| SMILES | N#C/C(=C(/O)CSc1nc(N)cc(=O)[nH]1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H11N5O2S2/c16-6-8(14-18-9-3-1-2-4-11(9)24-14)10(21)7-23-15-19-12(17)5-13(22)20-15/h1-5,21H,7H2,(H3,17,19,20,22)/b10-8- |
| InChIKey | BACUOSRLOYGYBO-NTMALXAHSA-N |
| XLogP | 2.55 |
| TPSA | 128.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|