C18H11N5O3S2 — CID 135677461
(Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]but-2-enenitrile (PubChem CID 135677461) has the molecular formula C18H11N5O3S2 and a molecular weight of 409.45 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]but-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]but-2-enenitrile |
|---|---|
| PubChem CID | 135677461 |
| Molecular Formula | C18H11N5O3S2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]but-2-enenitrile |
| SMILES | N#C/C(=C(/O)CSc1nc2ccc([N+](=O)[O-])cc2[nH]1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H11N5O3S2/c19-8-11(17-20-13-3-1-2-4-16(13)28-17)15(24)9-27-18-21-12-6-5-10(23(25)26)7-14(12)22-18/h1-7,24H,9H2,(H,21,22)/b15-11- |
| InChIKey | FFGGHSFNEKZKKK-PTNGSMBKSA-N |
| XLogP | 4.67 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|