C16H14N4OS4 — CID 135568626
(Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enenitrile (PubChem CID 135568626) has the molecular formula C16H14N4OS4 and a molecular weight of 406.58 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enenitrile |
|---|---|
| PubChem CID | 135568626 |
| Molecular Formula | C16H14N4OS4 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enenitrile |
| SMILES | CCCSc1nnc(SC/C(O)=C(\C#N)c2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C16H14N4OS4/c1-2-7-22-15-19-20-16(25-15)23-9-12(21)10(8-17)14-18-11-5-3-4-6-13(11)24-14/h3-6,21H,2,7,9H2,1H3/b12-10- |
| InChIKey | DNXZOXAGHLBHNX-BENRWUELSA-N |
| XLogP | 5.23 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|