C26H18N4O2S2 — CID 2340878
2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylbut-2-enenitrile (PubChem CID 2340878) has the molecular formula C26H18N4O2S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylbut-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylbut-2-enenitrile |
|---|---|
| PubChem CID | 2340878 |
| Molecular Formula | C26H18N4O2S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylbut-2-enenitrile |
| SMILES | Cc1ccc(-n2c(SCC(O)=C(C#N)c3nc4ccccc4s3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H18N4O2S2/c1-16-10-12-17(13-11-16)30-25(32)18-6-2-3-7-20(18)29-26(30)33-15-22(31)19(14-27)24-28-21-8-4-5-9-23(21)34-24/h2-13,31H,15H2,1H3 |
| InChIKey | HTCSNKVQAUZWKT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|