C21H18N4O2S — CID 40785577
2-ethanimidoyl-4-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanenitrile (PubChem CID 40785577) has the molecular formula C21H18N4O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is 2-ethanimidoyl-4-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanenitrile.
| Compound Name | 2-ethanimidoyl-4-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 40785577 |
| Molecular Formula | C21H18N4O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-ethanimidoyl-4-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanenitrile |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)CSc1nc2ccccc2c(=O)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C21H18N4O2S/c1-13-7-9-15(10-8-13)25-20(27)16-5-3-4-6-18(16)24-21(25)28-12-19(26)17(11-22)14(2)23/h3-10,17,23H,12H2,1-2H3/b23-14+ |
| InChIKey | ZCFIIUPFTMHMFP-OEAKJJBVSA-N |
| XLogP | 3.53 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|