C19H17N3OS — CID 7437989
4-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylbutanenitrile (PubChem CID 7437989) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylbutanenitrile.
| Compound Name | 4-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylbutanenitrile |
|---|---|
| PubChem CID | 7437989 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 4-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylbutanenitrile |
| SMILES | Cc1ccc(-n2c(SCCCC#N)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C19H17N3OS/c1-14-8-10-15(11-9-14)22-18(23)16-6-2-3-7-17(16)21-19(22)24-13-5-4-12-20/h2-3,6-11H,4-5,13H2,1H3 |
| InChIKey | GWOQUVJYXXAJOZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|