C20H18ClN3OS — CID 112779640
5-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylpentanenitrile (PubChem CID 112779640) has the molecular formula C20H18ClN3OS and a molecular weight of 383.90 g/mol. Its IUPAC name is 5-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylpentanenitrile.
| Compound Name | 5-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylpentanenitrile |
|---|---|
| PubChem CID | 112779640 |
| Molecular Formula | C20H18ClN3OS |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 5-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylpentanenitrile |
| SMILES | Cc1c(Cl)cccc1-n1c(SCCCCC#N)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H18ClN3OS/c1-14-16(21)9-7-11-18(14)24-19(25)15-8-3-4-10-17(15)23-20(24)26-13-6-2-5-12-22/h3-4,7-11H,2,5-6,13H2,1H3 |
| InChIKey | BATVZGWFSMKUIG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|