C22H23ClN2OS — CID 7853586
3-(3-chloro-2-methylphenyl)-2-(cyclohexylmethylsulfanyl)quinazolin-4-one (PubChem CID 7853586) has the molecular formula C22H23ClN2OS and a molecular weight of 398.96 g/mol. Its IUPAC name is 3-(3-chloro-2-methylphenyl)-2-(cyclohexylmethylsulfanyl)quinazolin-4-one.
| Compound Name | 3-(3-chloro-2-methylphenyl)-2-(cyclohexylmethylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 7853586 |
| Molecular Formula | C22H23ClN2OS |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 3-(3-chloro-2-methylphenyl)-2-(cyclohexylmethylsulfanyl)quinazolin-4-one |
| SMILES | Cc1c(Cl)cccc1-n1c(SCC2CCCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H23ClN2OS/c1-15-18(23)11-7-13-20(15)25-21(26)17-10-5-6-12-19(17)24-22(25)27-14-16-8-3-2-4-9-16/h5-7,10-13,16H,2-4,8-9,14H2,1H3 |
| InChIKey | NRLVOEWMNZSGDY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |