C23H24ClN3O2S — CID 16538336
2-[3-(2-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-cyclohexyl-N-methylacetamide (PubChem CID 16538336) has the molecular formula C23H24ClN3O2S and a molecular weight of 441.98 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-cyclohexyl-N-methylacetamide.
| Compound Name | 2-[3-(2-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-cyclohexyl-N-methylacetamide |
|---|---|
| PubChem CID | 16538336 |
| Molecular Formula | C23H24ClN3O2S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-cyclohexyl-N-methylacetamide |
| SMILES | CN(C(=O)CSc1nc2ccccc2c(=O)n1-c1ccccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C23H24ClN3O2S/c1-26(16-9-3-2-4-10-16)21(28)15-30-23-25-19-13-7-5-11-17(19)22(29)27(23)20-14-8-6-12-18(20)24/h5-8,11-14,16H,2-4,9-10,15H2,1H3 |
| InChIKey | NIDPEFGCXADRMH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |