C21H20ClN3OS — CID 7804647
4-[7-chloro-4-oxo-3-(2-propan-2-ylphenyl)quinazolin-2-yl]sulfanylbutanenitrile (PubChem CID 7804647) has the molecular formula C21H20ClN3OS and a molecular weight of 397.93 g/mol. Its IUPAC name is 4-[7-chloro-4-oxo-3-(2-propan-2-ylphenyl)quinazolin-2-yl]sulfanylbutanenitrile.
| Compound Name | 4-[7-chloro-4-oxo-3-(2-propan-2-ylphenyl)quinazolin-2-yl]sulfanylbutanenitrile |
|---|---|
| PubChem CID | 7804647 |
| Molecular Formula | C21H20ClN3OS |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 4-[7-chloro-4-oxo-3-(2-propan-2-ylphenyl)quinazolin-2-yl]sulfanylbutanenitrile |
| SMILES | CC(C)c1ccccc1-n1c(SCCCC#N)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H20ClN3OS/c1-14(2)16-7-3-4-8-19(16)25-20(26)17-10-9-15(22)13-18(17)24-21(25)27-12-6-5-11-23/h3-4,7-10,13-14H,5-6,12H2,1-2H3 |
| InChIKey | HMRZXAMYRAICOU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|