C23H18N6O2S2 — CID 135959703
(Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(5-oxo-4-propyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]but-2-enenitrile (PubChem CID 135959703) has the molecular formula C23H18N6O2S2 and a molecular weight of 474.57 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(5-oxo-4-propyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]but-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(5-oxo-4-propyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]but-2-enenitrile |
|---|---|
| PubChem CID | 135959703 |
| Molecular Formula | C23H18N6O2S2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(5-oxo-4-propyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]but-2-enenitrile |
| SMILES | CCCn1c(=O)c2ccccc2n2c(SC/C(O)=C(\C#N)c3nc4ccccc4s3)nnc12 |
| InChI | InChI=1S/C23H18N6O2S2/c1-2-11-28-21(31)14-7-3-5-9-17(14)29-22(28)26-27-23(29)32-13-18(30)15(12-24)20-25-16-8-4-6-10-19(16)33-20/h3-10,30H,2,11,13H2,1H3/b18-15- |
| InChIKey | IQJZWPIHABNSSM-SDXDJHTJSA-N |
| XLogP | 4.65 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|