C23H17N7O2S — CID 135788651
(Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]but-2-enenitrile (PubChem CID 135788651) has the molecular formula C23H17N7O2S and a molecular weight of 455.50 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]but-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]but-2-enenitrile |
|---|---|
| PubChem CID | 135788651 |
| Molecular Formula | C23H17N7O2S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]but-2-enenitrile |
| SMILES | C=CCn1c(=O)c2ccccc2n2c(SC/C(O)=C(\C#N)c3nc4ccccc4[nH]3)nnc12 |
| InChI | InChI=1S/C23H17N7O2S/c1-2-11-29-21(32)14-7-3-6-10-18(14)30-22(29)27-28-23(30)33-13-19(31)15(12-24)20-25-16-8-4-5-9-17(16)26-20/h2-10,31H,1,11,13H2,(H,25,26)/b19-15- |
| InChIKey | XWTDETSHWGYMMZ-CYVLTUHYSA-N |
| XLogP | 3.69 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|