C23H19FN6O2S — CID 135521249
(Z)-2-(1H-benzimidazol-2-yl)-4-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 135521249) has the molecular formula C23H19FN6O2S and a molecular weight of 462.51 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-4-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135521249 |
| Molecular Formula | C23H19FN6O2S |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | C=CCn1c(COc2ccc(F)cc2)nnc1SC/C(O)=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H19FN6O2S/c1-2-11-30-21(13-32-16-9-7-15(24)8-10-16)28-29-23(30)33-14-20(31)17(12-25)22-26-18-5-3-4-6-19(18)27-22/h2-10,31H,1,11,13-14H2,(H,26,27)/b20-17- |
| InChIKey | QEVXUSJVHINTDU-JZJYNLBNSA-N |
| XLogP | 4.64 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|