C26H25FN4O2S — CID 3262127
1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 3262127) has the molecular formula C26H25FN4O2S and a molecular weight of 476.58 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 3262127 |
| Molecular Formula | C26H25FN4O2S |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | C=CCn1c(COc2ccc(F)cc2)nnc1SCC(=O)c1cc(C)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C26H25FN4O2S/c1-4-14-30-25(16-33-22-12-10-20(27)11-13-22)28-29-26(30)34-17-24(32)23-15-18(2)31(19(23)3)21-8-6-5-7-9-21/h4-13,15H,1,14,16-17H2,2-3H3 |
| InChIKey | MZHWDXKIAFWQON-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|