C28H21FN4O4S — CID 5233275
N-(9,10-dioxoanthracen-2-yl)-2-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 5233275) has the molecular formula C28H21FN4O4S and a molecular weight of 528.57 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 5233275 |
| Molecular Formula | C28H21FN4O4S |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(COc2ccc(F)cc2)nnc1SCC(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H21FN4O4S/c1-2-13-33-24(15-37-19-10-7-17(29)8-11-19)31-32-28(33)38-16-25(34)30-18-9-12-22-23(14-18)27(36)21-6-4-3-5-20(21)26(22)35/h2-12,14H,1,13,15-16H2,(H,30,34) |
| InChIKey | IEGDMZIEONGKCW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|