C20H16F4N4O2S — CID 4516238
2-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 4516238) has the molecular formula C20H16F4N4O2S and a molecular weight of 452.43 g/mol. Its IUPAC name is 2-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 4516238 |
| Molecular Formula | C20H16F4N4O2S |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 2-[[5-[(4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | C=CCn1c(COc2ccc(F)cc2)nnc1SCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H16F4N4O2S/c1-2-9-28-16(10-30-13-5-3-12(21)4-6-13)26-27-20(28)31-11-17(29)25-15-8-7-14(22)18(23)19(15)24/h2-8H,1,9-11H2,(H,25,29) |
| InChIKey | UGKQNQCIGCUQPV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|