C26H19ClN6OS — CID 2450985
2-(1H-benzimidazol-2-yl)-4-[[4-benzyl-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 2450985) has the molecular formula C26H19ClN6OS and a molecular weight of 499.00 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-4-[[4-benzyl-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-4-[[4-benzyl-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 2450985 |
| Molecular Formula | C26H19ClN6OS |
| Molecular Weight | 499.00 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-4-[[4-benzyl-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | N#CC(=C(O)CSc1nnc(-c2ccccc2Cl)n1Cc1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H19ClN6OS/c27-20-11-5-4-10-18(20)25-31-32-26(33(25)15-17-8-2-1-3-9-17)35-16-23(34)19(14-28)24-29-21-12-6-7-13-22(21)30-24/h1-13,34H,15-16H2,(H,29,30) |
| InChIKey | ZYQYPKMFQVYYSZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.00 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|