C25H16F2N6OS — CID 135466180
(Z)-2-(1H-benzimidazol-2-yl)-4-[[4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 135466180) has the molecular formula C25H16F2N6OS and a molecular weight of 486.51 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-4-[[4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[[4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135466180 |
| Molecular Formula | C25H16F2N6OS |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[[4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | N#C/C(=C(/O)CSc1nnc(-c2ccccc2)n1-c1ccc(F)cc1F)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H16F2N6OS/c26-16-10-11-21(18(27)12-16)33-24(15-6-2-1-3-7-15)31-32-25(33)35-14-22(34)17(13-28)23-29-19-8-4-5-9-20(19)30-23/h1-12,34H,14H2,(H,29,30)/b22-17- |
| InChIKey | YDIDYZXEAFRPCC-XLNRJJMWSA-N |
| XLogP | 5.67 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|