C26H18N6O3S — CID 135719855
(Z)-2-(1H-benzimidazol-2-yl)-4-[[5-(1,3-benzodioxol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 135719855) has the molecular formula C26H18N6O3S and a molecular weight of 494.54 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-4-[[5-(1,3-benzodioxol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[[5-(1,3-benzodioxol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135719855 |
| Molecular Formula | C26H18N6O3S |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[[5-(1,3-benzodioxol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | N#C/C(=C(/O)CSc1nnc(-c2ccc3c(c2)OCO3)n1-c1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H18N6O3S/c27-13-18(24-28-19-8-4-5-9-20(19)29-24)21(33)14-36-26-31-30-25(32(26)17-6-2-1-3-7-17)16-10-11-22-23(12-16)35-15-34-22/h1-12,33H,14-15H2,(H,28,29)/b21-18- |
| InChIKey | ISOIVCIRRPSTDX-UZYVYHOESA-N |
| XLogP | 5.12 |
| TPSA | 121.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|