C20H13N5O4S — CID 135760824
(Z)-2-(1H-benzimidazol-2-yl)-4-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 135760824) has the molecular formula C20H13N5O4S and a molecular weight of 419.42 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-4-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135760824 |
| Molecular Formula | C20H13N5O4S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | N#C/C(=C(/O)CSc1nnc(-c2ccc3c(c2)OCO3)o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H13N5O4S/c21-8-12(18-22-13-3-1-2-4-14(13)23-18)15(26)9-30-20-25-24-19(29-20)11-5-6-16-17(7-11)28-10-27-16/h1-7,26H,9-10H2,(H,22,23)/b15-12- |
| InChIKey | XVUROYOSNZYYHJ-QINSGFPZSA-N |
| XLogP | 3.93 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|