C21H16ClN5OS2 — CID 135959689
(Z)-2-(1,3-benzothiazol-2-yl)-4-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 135959689) has the molecular formula C21H16ClN5OS2 and a molecular weight of 453.98 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-4-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-4-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135959689 |
| Molecular Formula | C21H16ClN5OS2 |
| Molecular Weight | 453.98 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-4-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | CCn1c(SC/C(O)=C(\C#N)c2nc3ccccc3s2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClN5OS2/c1-2-27-19(13-7-9-14(22)10-8-13)25-26-21(27)29-12-17(28)15(11-23)20-24-16-5-3-4-6-18(16)30-20/h3-10,28H,2,12H2,1H3/b17-15- |
| InChIKey | ZBFAOJFSSDIXLW-ICFOKQHNSA-N |
| XLogP | 5.81 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.98 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|