C25H18N6OS2 — CID 2406967
2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]but-2-enenitrile (PubChem CID 2406967) has the molecular formula C25H18N6OS2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]but-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]but-2-enenitrile |
|---|---|
| PubChem CID | 2406967 |
| Molecular Formula | C25H18N6OS2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]but-2-enenitrile |
| SMILES | Cc1ccccc1-n1c(SCC(O)=C(C#N)c2nc3ccccc3s2)nnc1-c1cccnc1 |
| InChI | InChI=1S/C25H18N6OS2/c1-16-7-2-4-10-20(16)31-23(17-8-6-12-27-14-17)29-30-25(31)33-15-21(32)18(13-26)24-28-19-9-3-5-11-22(19)34-24/h2-12,14,32H,15H2,1H3 |
| InChIKey | RXPVTEMEGSPWKY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|