C24H20N6OS — CID 31096963
N-(cyanomethyl)-2-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide (PubChem CID 31096963) has the molecular formula C24H20N6OS and a molecular weight of 440.53 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | N-(cyanomethyl)-2-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 31096963 |
| Molecular Formula | C24H20N6OS |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-(cyanomethyl)-2-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
| SMILES | Cc1ccccc1-n1c(SCC(=O)N(CC#N)c2ccccc2)nnc1-c1cccnc1 |
| InChI | InChI=1S/C24H20N6OS/c1-18-8-5-6-12-21(18)30-23(19-9-7-14-26-16-19)27-28-24(30)32-17-22(31)29(15-13-25)20-10-3-2-4-11-20/h2-12,14,16H,15,17H2,1H3 |
| InChIKey | MDMUTPYDRXDWCN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|