C21H18ClN5O2S2 — CID 135883416
(Z)-2-(5-chloro-1,3-benzothiazol-2-yl)-4-[[4-(furan-2-ylmethyl)-5-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 135883416) has the molecular formula C21H18ClN5O2S2 and a molecular weight of 472.00 g/mol. Its IUPAC name is (Z)-2-(5-chloro-1,3-benzothiazol-2-yl)-4-[[4-(furan-2-ylmethyl)-5-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-2-(5-chloro-1,3-benzothiazol-2-yl)-4-[[4-(furan-2-ylmethyl)-5-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135883416 |
| Molecular Formula | C21H18ClN5O2S2 |
| Molecular Weight | 472.00 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | (Z)-2-(5-chloro-1,3-benzothiazol-2-yl)-4-[[4-(furan-2-ylmethyl)-5-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | CC(C)c1nnc(SC/C(O)=C(\C#N)c2nc3cc(Cl)ccc3s2)n1Cc1ccco1 |
| InChI | InChI=1S/C21H18ClN5O2S2/c1-12(2)19-25-26-21(27(19)10-14-4-3-7-29-14)30-11-17(28)15(9-23)20-24-16-8-13(22)5-6-18(16)31-20/h3-8,12,28H,10-11H2,1-2H3/b17-15- |
| InChIKey | FIVGNKVZBNZPHB-ICFOKQHNSA-N |
| XLogP | 5.89 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.00 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|