C11H6Cl2N2OS — CID 170997464
(E)-4-chloro-2-(5-chloro-1,3-benzothiazol-2-yl)-3-hydroxybut-2-enenitrile (PubChem CID 170997464) has the molecular formula C11H6Cl2N2OS and a molecular weight of 285.16 g/mol. Its IUPAC name is (E)-4-chloro-2-(5-chloro-1,3-benzothiazol-2-yl)-3-hydroxybut-2-enenitrile.
| Compound Name | (E)-4-chloro-2-(5-chloro-1,3-benzothiazol-2-yl)-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 170997464 |
| Molecular Formula | C11H6Cl2N2OS |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | (E)-4-chloro-2-(5-chloro-1,3-benzothiazol-2-yl)-3-hydroxybut-2-enenitrile |
| SMILES | N#C/C(=C(\O)CCl)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C11H6Cl2N2OS/c12-4-9(16)7(5-14)11-15-8-3-6(13)1-2-10(8)17-11/h1-3,16H,4H2/b9-7+ |
| InChIKey | UHRZXYIHBPQWMZ-VQHVLOKHSA-N |
| XLogP | 3.98 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|