C14H6Cl2N2OS2 — CID 135427147
(Z)-2-(1,3-benzothiazol-2-yl)-3-(2,5-dichlorothiophen-3-yl)-3-hydroxyprop-2-enenitrile (PubChem CID 135427147) has the molecular formula C14H6Cl2N2OS2 and a molecular weight of 353.26 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-(2,5-dichlorothiophen-3-yl)-3-hydroxyprop-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-(2,5-dichlorothiophen-3-yl)-3-hydroxyprop-2-enenitrile |
|---|---|
| PubChem CID | 135427147 |
| Molecular Formula | C14H6Cl2N2OS2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-(2,5-dichlorothiophen-3-yl)-3-hydroxyprop-2-enenitrile |
| SMILES | N#C/C(=C(/O)c1cc(Cl)sc1Cl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H6Cl2N2OS2/c15-11-5-7(13(16)21-11)12(19)8(6-17)14-18-9-3-1-2-4-10(9)20-14/h1-5,19H/b12-8- |
| InChIKey | KONDBYBEQUOVMH-WQLSENKSSA-N |
| XLogP | 5.61 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|