C15H9ClN4S — CID 5063724
N-(3-chloroanilino)-1,3-benzothiazole-2-carboximidoyl cyanide (PubChem CID 5063724) has the molecular formula C15H9ClN4S and a molecular weight of 312.79 g/mol. Its IUPAC name is N-(3-chloroanilino)-1,3-benzothiazole-2-carboximidoyl cyanide.
| Compound Name | N-(3-chloroanilino)-1,3-benzothiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 5063724 |
| Molecular Formula | C15H9ClN4S |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | N-(3-chloroanilino)-1,3-benzothiazole-2-carboximidoyl cyanide |
| SMILES | N#CC(=NNc1cccc(Cl)c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H9ClN4S/c16-10-4-3-5-11(8-10)19-20-13(9-17)15-18-12-6-1-2-7-14(12)21-15/h1-8,19H |
| InChIKey | SMSORCAUGUQOCQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|