C16H10N4O2S — CID 4047484
N-(1,3-benzodioxol-5-ylamino)-1,3-benzothiazole-2-carboximidoyl cyanide (PubChem CID 4047484) has the molecular formula C16H10N4O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylamino)-1,3-benzothiazole-2-carboximidoyl cyanide.
| Compound Name | N-(1,3-benzodioxol-5-ylamino)-1,3-benzothiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 4047484 |
| Molecular Formula | C16H10N4O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylamino)-1,3-benzothiazole-2-carboximidoyl cyanide |
| SMILES | N#CC(=NNc1ccc2c(c1)OCO2)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H10N4O2S/c17-8-12(16-18-11-3-1-2-4-15(11)23-16)20-19-10-5-6-13-14(7-10)22-9-21-13/h1-7,19H,9H2 |
| InChIKey | UGWBXMJOJVBOIL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|