C19H14N4O2S — CID 4202045
4-(1,3-benzodioxol-5-yl)-N-(4-methylanilino)-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 4202045) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-(4-methylanilino)-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-(4-methylanilino)-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 4202045 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-(4-methylanilino)-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | Cc1ccc(NN=C(C#N)c2nc(-c3ccc4c(c3)OCO4)cs2)cc1 |
| InChI | InChI=1S/C19H14N4O2S/c1-12-2-5-14(6-3-12)22-23-15(9-20)19-21-16(10-26-19)13-4-7-17-18(8-13)25-11-24-17/h2-8,10,22H,11H2,1H3 |
| InChIKey | AQTUHLBDXLRPKF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|