C22H16N4S — CID 3818504
N-(4-methylanilino)-4-naphthalen-1-yl-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 3818504) has the molecular formula C22H16N4S and a molecular weight of 368.47 g/mol. Its IUPAC name is N-(4-methylanilino)-4-naphthalen-1-yl-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | N-(4-methylanilino)-4-naphthalen-1-yl-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 3818504 |
| Molecular Formula | C22H16N4S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N-(4-methylanilino)-4-naphthalen-1-yl-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | Cc1ccc(NN=C(C#N)c2nc(-c3cccc4ccccc34)cs2)cc1 |
| InChI | InChI=1S/C22H16N4S/c1-15-9-11-17(12-10-15)25-26-20(13-23)22-24-21(14-27-22)19-8-4-6-16-5-2-3-7-18(16)19/h2-12,14,25H,1H3 |
| InChIKey | UZEVHBDXFBLUFO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|