C18H15N5O2S — CID 163170507
3-[2-[cyano-[4-(4-methylphenyl)-1,3-thiazol-2-yl]methylidene]hydrazinyl]-N-hydroxybenzeneamine oxide (PubChem CID 163170507) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is 3-[2-[cyano-[4-(4-methylphenyl)-1,3-thiazol-2-yl]methylidene]hydrazinyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[2-[cyano-[4-(4-methylphenyl)-1,3-thiazol-2-yl]methylidene]hydrazinyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163170507 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-[2-[cyano-[4-(4-methylphenyl)-1,3-thiazol-2-yl]methylidene]hydrazinyl]-N-hydroxybenzeneamine oxide |
| SMILES | Cc1ccc(-c2csc(C(C#N)=NNc3cccc([NH+]([O-])O)c3)n2)cc1 |
| InChI | InChI=1S/C18H15N5O2S/c1-12-5-7-13(8-6-12)17-11-26-18(20-17)16(10-19)22-21-14-3-2-4-15(9-14)23(24)25/h2-9,11,21,23-24H,1H3 |
| InChIKey | VEJJCIWFJSDTDL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|