C20H19N5O2S2 — CID 25214941
(2Z)-4-[4-(dimethylsulfamoyl)phenyl]-N-(4-methylanilino)-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 25214941) has the molecular formula C20H19N5O2S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is (2Z)-4-[4-(dimethylsulfamoyl)phenyl]-N-(4-methylanilino)-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | (2Z)-4-[4-(dimethylsulfamoyl)phenyl]-N-(4-methylanilino)-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 25214941 |
| Molecular Formula | C20H19N5O2S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | (2Z)-4-[4-(dimethylsulfamoyl)phenyl]-N-(4-methylanilino)-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | Cc1ccc(N/N=C(/C#N)c2nc(-c3ccc(S(=O)(=O)N(C)C)cc3)cs2)cc1 |
| InChI | InChI=1S/C20H19N5O2S2/c1-14-4-8-16(9-5-14)23-24-18(12-21)20-22-19(13-28-20)15-6-10-17(11-7-15)29(26,27)25(2)3/h4-11,13,23H,1-3H3/b24-18- |
| InChIKey | ZNSBHAWQYDGWBS-MOHJPFBDSA-N |
| XLogP | 3.71 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|