C16H12N6S — CID 150721183
4-methyl-N-(4-pyrimidin-2-ylanilino)-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 150721183) has the molecular formula C16H12N6S and a molecular weight of 320.38 g/mol. Its IUPAC name is 4-methyl-N-(4-pyrimidin-2-ylanilino)-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | 4-methyl-N-(4-pyrimidin-2-ylanilino)-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 150721183 |
| Molecular Formula | C16H12N6S |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-methyl-N-(4-pyrimidin-2-ylanilino)-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | Cc1csc(C(C#N)=NNc2ccc(-c3ncccn3)cc2)n1 |
| InChI | InChI=1S/C16H12N6S/c1-11-10-23-16(20-11)14(9-17)22-21-13-5-3-12(4-6-13)15-18-7-2-8-19-15/h2-8,10,21H,1H3 |
| InChIKey | JPWSHNYKYKWGSA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|