C15H10N6S — CID 154945857
2-hydrazinylidene-2-[4-(4-pyrimidin-2-ylphenyl)-1,3-thiazol-2-yl]acetonitrile (PubChem CID 154945857) has the molecular formula C15H10N6S and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-hydrazinylidene-2-[4-(4-pyrimidin-2-ylphenyl)-1,3-thiazol-2-yl]acetonitrile.
| Compound Name | 2-hydrazinylidene-2-[4-(4-pyrimidin-2-ylphenyl)-1,3-thiazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 154945857 |
| Molecular Formula | C15H10N6S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-hydrazinylidene-2-[4-(4-pyrimidin-2-ylphenyl)-1,3-thiazol-2-yl]acetonitrile |
| SMILES | N#CC(=NN)c1nc(-c2ccc(-c3ncccn3)cc2)cs1 |
| InChI | InChI=1S/C15H10N6S/c16-8-12(21-17)15-20-13(9-22-15)10-2-4-11(5-3-10)14-18-6-1-7-19-14/h1-7,9H,17H2 |
| InChIKey | NAVDYIQVGVJSPW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|